C20H30N6O2 — CID 133461730
3-(1-methoxyethyl)-5-[[4-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 133461730) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-(1-methoxyethyl)-5-[[4-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-methoxyethyl)-5-[[4-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133461730 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 3-(1-methoxyethyl)-5-[[4-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | COC(C)c1noc(CN2CCCN(c3nc(C)nc4c3CCCC4)CC2)n1 |
| InChI | InChI=1S/C20H30N6O2/c1-14(27-3)19-23-18(28-24-19)13-25-9-6-10-26(12-11-25)20-16-7-4-5-8-17(16)21-15(2)22-20/h14H,4-13H2,1-3H3 |
| InChIKey | PBJCPPMPJJSKRZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |