C20H24ClN5O2 — CID 133337585
5-[[4-(1-chloroisoquinolin-3-yl)-1,4-diazepan-1-yl]methyl]-3-(1-methoxyethyl)-1,2,4-oxadiazole (PubChem CID 133337585) has the molecular formula C20H24ClN5O2 and a molecular weight of 401.90 g/mol. Its IUPAC name is 5-[[4-(1-chloroisoquinolin-3-yl)-1,4-diazepan-1-yl]methyl]-3-(1-methoxyethyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[4-(1-chloroisoquinolin-3-yl)-1,4-diazepan-1-yl]methyl]-3-(1-methoxyethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133337585 |
| Molecular Formula | C20H24ClN5O2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 5-[[4-(1-chloroisoquinolin-3-yl)-1,4-diazepan-1-yl]methyl]-3-(1-methoxyethyl)-1,2,4-oxadiazole |
| SMILES | COC(C)c1noc(CN2CCCN(c3cc4ccccc4c(Cl)n3)CC2)n1 |
| InChI | InChI=1S/C20H24ClN5O2/c1-14(27-2)20-23-18(28-24-20)13-25-8-5-9-26(11-10-25)17-12-15-6-3-4-7-16(15)19(21)22-17/h3-4,6-7,12,14H,5,8-11,13H2,1-2H3 |
| InChIKey | LVEPBFAQPJFDCS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|