C17H19ClN6 — CID 133452296
1-chloro-3-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]isoquinoline (PubChem CID 133452296) has the molecular formula C17H19ClN6 and a molecular weight of 342.83 g/mol. Its IUPAC name is 1-chloro-3-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]isoquinoline.
| Compound Name | 1-chloro-3-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]isoquinoline |
|---|---|
| PubChem CID | 133452296 |
| Molecular Formula | C17H19ClN6 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-chloro-3-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]isoquinoline |
| SMILES | Cc1nc(CN2CCN(c3cc4ccccc4c(Cl)n3)CC2)n[nH]1 |
| InChI | InChI=1S/C17H19ClN6/c1-12-19-15(22-21-12)11-23-6-8-24(9-7-23)16-10-13-4-2-3-5-14(13)17(18)20-16/h2-5,10H,6-9,11H2,1H3,(H,19,21,22) |
| InChIKey | GURDBMZNCBKPOY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|