C22H26N8O2 — CID 133337620
3-(1-methoxyethyl)-5-[[4-(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 133337620) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-(1-methoxyethyl)-5-[[4-(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-methoxyethyl)-5-[[4-(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133337620 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 3-(1-methoxyethyl)-5-[[4-(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | COC(C)c1noc(CN2CCCN(c3cc(-c4ccccc4)nc4ncnn34)CC2)n1 |
| InChI | InChI=1S/C22H26N8O2/c1-16(31-2)21-26-19(32-27-21)14-28-9-6-10-29(12-11-28)20-13-18(17-7-4-3-5-8-17)25-22-23-15-24-30(20)22/h3-5,7-8,13,15-16H,6,9-12,14H2,1-2H3 |
| InChIKey | FPRXHVFXGNWHSX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |