C9H11FN2O2 — CID 106670856
1-(6-fluoro-2-pyridinyl)pyrrolidine-3,4-diol (PubChem CID 106670856) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is 1-(6-fluoro-2-pyridinyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(6-fluoro-2-pyridinyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670856 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-(6-fluoro-2-pyridinyl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(c2cccc(F)n2)CC1O |
| InChI | InChI=1S/C9H11FN2O2/c10-8-2-1-3-9(11-8)12-4-6(13)7(14)5-12/h1-3,6-7,13-14H,4-5H2 |
| InChIKey | GBVLPQCJYGTHJA-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|