C11H15FN2O2 — CID 103536645
2-(3,4-dimethoxypyrrolidin-1-yl)-6-fluoropyridine (PubChem CID 103536645) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-(3,4-dimethoxypyrrolidin-1-yl)-6-fluoropyridine.
| Compound Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-6-fluoropyridine |
|---|---|
| PubChem CID | 103536645 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-6-fluoropyridine |
| SMILES | COC1CN(c2cccc(F)n2)CC1OC |
| InChI | InChI=1S/C11H15FN2O2/c1-15-8-6-14(7-9(8)16-2)11-5-3-4-10(12)13-11/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | HFYHRAXTGKRDOS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|