C15H21N3O — CID 134074831
1-(2-pyridin-2-yl-2,7-diazaspiro[4.5]decan-7-yl)ethanone (PubChem CID 134074831) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(2-pyridin-2-yl-2,7-diazaspiro[4.5]decan-7-yl)ethanone.
| Compound Name | 1-(2-pyridin-2-yl-2,7-diazaspiro[4.5]decan-7-yl)ethanone |
|---|---|
| PubChem CID | 134074831 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-(2-pyridin-2-yl-2,7-diazaspiro[4.5]decan-7-yl)ethanone |
| SMILES | CC(=O)N1CCCC2(CCN(c3ccccn3)C2)C1 |
| InChI | InChI=1S/C15H21N3O/c1-13(19)17-9-4-6-15(11-17)7-10-18(12-15)14-5-2-3-8-16-14/h2-3,5,8H,4,6-7,9-12H2,1H3 |
| InChIKey | BPMJMHLJDZCKKX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |