C21H25N3O2 — CID 3233977
phenyl 2-pyridin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 3233977) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is phenyl 2-pyridin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | phenyl 2-pyridin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 3233977 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | phenyl 2-pyridin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCC2(CCCN(c3ccccn3)C2)CC1 |
| InChI | InChI=1S/C21H25N3O2/c25-20(26-18-7-2-1-3-8-18)23-15-11-21(12-16-23)10-6-14-24(17-21)19-9-4-5-13-22-19/h1-5,7-9,13H,6,10-12,14-17H2 |
| InChIKey | ALVMYTXDIDVNBL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |