C19H22N4O2 — CID 3234058
phenyl (5S)-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane-7-carboxylate (PubChem CID 3234058) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is phenyl (5S)-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane-7-carboxylate.
| Compound Name | phenyl (5S)-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 3234058 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | phenyl (5S)-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane-7-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCC[C@@]2(CCN(c3ncccn3)C2)C1 |
| InChI | InChI=1S/C19H22N4O2/c24-18(25-16-6-2-1-3-7-16)23-12-4-8-19(15-23)9-13-22(14-19)17-20-10-5-11-21-17/h1-3,5-7,10-11H,4,8-9,12-15H2/t19-/m0/s1 |
| InChIKey | ZTZNPEAFKDHEEG-IBGZPJMESA-N |
| XLogP | 2.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |