C16H20N6 — CID 97369995
2,8-di(pyrimidin-2-yl)-2,8-diazaspiro[4.5]decane (PubChem CID 97369995) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2,8-di(pyrimidin-2-yl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 2,8-di(pyrimidin-2-yl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 97369995 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2,8-di(pyrimidin-2-yl)-2,8-diazaspiro[4.5]decane |
| SMILES | c1cnc(N2CCC3(CC2)CCN(c2ncccn2)C3)nc1 |
| InChI | InChI=1S/C16H20N6/c1-6-17-14(18-7-1)21-10-3-16(4-11-21)5-12-22(13-16)15-19-8-2-9-20-15/h1-2,6-9H,3-5,10-13H2 |
| InChIKey | OPPCNYUAZNVVMG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |