C12H18N4 — CID 171070249
2-methyl-7-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane (PubChem CID 171070249) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-methyl-7-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane.
| Compound Name | 2-methyl-7-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 171070249 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-methyl-7-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane |
| SMILES | CN1CC2(CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C12H18N4/c1-15-9-12(10-15)3-7-16(8-4-12)11-13-5-2-6-14-11/h2,5-6H,3-4,7-10H2,1H3 |
| InChIKey | RZJGSHUIXVSJJS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |