C12H19N4P — CID 171070043
methyl-(7-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonan-2-yl)phosphane (PubChem CID 171070043) has the molecular formula C12H19N4P and a molecular weight of 250.29 g/mol. Its IUPAC name is methyl-(7-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonan-2-yl)phosphane.
| Compound Name | methyl-(7-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonan-2-yl)phosphane |
|---|---|
| PubChem CID | 171070043 |
| Molecular Formula | C12H19N4P |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | methyl-(7-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonan-2-yl)phosphane |
| SMILES | CPN1CC2(CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C12H19N4P/c1-17-16-9-12(10-16)3-7-15(8-4-12)11-13-5-2-6-14-11/h2,5-6,17H,3-4,7-10H2,1H3 |
| InChIKey | HWNAAUKYLUMSDQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|