C13H18N4O — CID 175822956
2-methyl-8-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 175822956) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-methyl-8-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-methyl-8-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 175822956 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-methyl-8-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | CN1CC2(CCN(c3ncccn3)CC2)CC1=O |
| InChI | InChI=1S/C13H18N4O/c1-16-10-13(9-11(16)18)3-7-17(8-4-13)12-14-5-2-6-15-12/h2,5-6H,3-4,7-10H2,1H3 |
| InChIKey | PWSVPUUYCGDMDO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |