C19H22N4O — CID 70746319
2-benzyl-8-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 70746319) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-benzyl-8-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-benzyl-8-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 70746319 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-benzyl-8-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCN(c3ncccn3)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N4O/c24-17-13-19(15-23(17)14-16-5-2-1-3-6-16)7-11-22(12-8-19)18-20-9-4-10-21-18/h1-6,9-10H,7-8,11-15H2 |
| InChIKey | YQBMMJRRIPCMQV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |