C20H22N4O2 — CID 72853673
2-benzyl-8-(pyrazine-2-carbonyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 72853673) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-benzyl-8-(pyrazine-2-carbonyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-benzyl-8-(pyrazine-2-carbonyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 72853673 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-benzyl-8-(pyrazine-2-carbonyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCN(C(=O)c3cnccn3)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H22N4O2/c25-18-12-20(15-24(18)14-16-4-2-1-3-5-16)6-10-23(11-7-20)19(26)17-13-21-8-9-22-17/h1-5,8-9,13H,6-7,10-12,14-15H2 |
| InChIKey | OGIWNKWCLODYBY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |