C22H26N4O6 — CID 155826391
formic acid;8-(pyridine-2-carbonyl)-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 155826391) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is formic acid;8-(pyridine-2-carbonyl)-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | formic acid;8-(pyridine-2-carbonyl)-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 155826391 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | formic acid;8-(pyridine-2-carbonyl)-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCN(C(=O)c3ccccn3)CC2)CN1Cc1ccncc1.O=CO.O=CO |
| InChI | InChI=1S/C20H22N4O2.2CH2O2/c25-18-13-20(15-24(18)14-16-4-9-21-10-5-16)6-11-23(12-7-20)19(26)17-3-1-2-8-22-17;2*2-1-3/h1-5,8-10H,6-7,11-15H2;2*1H,(H,2,3) |
| InChIKey | PABHSRMNUAYGJF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|