C19H25N3O2 — CID 98894942
8-(3-methylbut-2-enoyl)-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 98894942) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 8-(3-methylbut-2-enoyl)-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(3-methylbut-2-enoyl)-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 98894942 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 8-(3-methylbut-2-enoyl)-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC(C)=CC(=O)N1CCC2(CC1)CC(=O)N(Cc1ccncc1)C2 |
| InChI | InChI=1S/C19H25N3O2/c1-15(2)11-17(23)21-9-5-19(6-10-21)12-18(24)22(14-19)13-16-3-7-20-8-4-16/h3-4,7-8,11H,5-6,9-10,12-14H2,1-2H3 |
| InChIKey | VPTCPPLBWMALSI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|