C22H28N4O4 — CID 155870326
formic acid;2-(pyridin-4-ylmethyl)-8-[3-(1H-pyrrol-2-yl)propanoyl]-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 155870326) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is formic acid;2-(pyridin-4-ylmethyl)-8-[3-(1H-pyrrol-2-yl)propanoyl]-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | formic acid;2-(pyridin-4-ylmethyl)-8-[3-(1H-pyrrol-2-yl)propanoyl]-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 155870326 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | formic acid;2-(pyridin-4-ylmethyl)-8-[3-(1H-pyrrol-2-yl)propanoyl]-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C(CCc1ccc[nH]1)N1CCC2(CC1)CC(=O)N(Cc1ccncc1)C2.O=CO |
| InChI | InChI=1S/C21H26N4O2.CH2O2/c26-19(4-3-18-2-1-9-23-18)24-12-7-21(8-13-24)14-20(27)25(16-21)15-17-5-10-22-11-6-17;2-1-3/h1-2,5-6,9-11,23H,3-4,7-8,12-16H2;1H,(H,2,3) |
| InChIKey | UQDIHLQLIWIMOR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|