C22H22F2N2O2 — CID 72838673
2-benzyl-8-(2,3-difluorobenzoyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 72838673) has the molecular formula C22H22F2N2O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-benzyl-8-(2,3-difluorobenzoyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-benzyl-8-(2,3-difluorobenzoyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 72838673 |
| Molecular Formula | C22H22F2N2O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-benzyl-8-(2,3-difluorobenzoyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCN(C(=O)c3cccc(F)c3F)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H22F2N2O2/c23-18-8-4-7-17(20(18)24)21(28)25-11-9-22(10-12-25)13-19(27)26(15-22)14-16-5-2-1-3-6-16/h1-8H,9-15H2 |
| InChIKey | GMKAASVYZYLWTK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |