C21H20Cl2FN3O2 — CID 155870779
8-(4,6-dichloropyridine-3-carbonyl)-2-[(3-fluorophenyl)methyl]-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 155870779) has the molecular formula C21H20Cl2FN3O2 and a molecular weight of 436.31 g/mol. Its IUPAC name is 8-(4,6-dichloropyridine-3-carbonyl)-2-[(3-fluorophenyl)methyl]-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(4,6-dichloropyridine-3-carbonyl)-2-[(3-fluorophenyl)methyl]-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 155870779 |
| Molecular Formula | C21H20Cl2FN3O2 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 8-(4,6-dichloropyridine-3-carbonyl)-2-[(3-fluorophenyl)methyl]-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCN(C(=O)c3cnc(Cl)cc3Cl)CC2)CN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C21H20Cl2FN3O2/c22-17-9-18(23)25-11-16(17)20(29)26-6-4-21(5-7-26)10-19(28)27(13-21)12-14-2-1-3-15(24)8-14/h1-3,8-9,11H,4-7,10,12-13H2 |
| InChIKey | JZSXDNDHQZGVKC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|