C24H29N3O2 — CID 72877372
8-[(2S)-2-amino-3-phenylpropanoyl]-2-benzyl-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 72877372) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 8-[(2S)-2-amino-3-phenylpropanoyl]-2-benzyl-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-[(2S)-2-amino-3-phenylpropanoyl]-2-benzyl-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 72877372 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 8-[(2S)-2-amino-3-phenylpropanoyl]-2-benzyl-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N1CCC2(CC1)CC(=O)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H29N3O2/c25-21(15-19-7-3-1-4-8-19)23(29)26-13-11-24(12-14-26)16-22(28)27(18-24)17-20-9-5-2-6-10-20/h1-10,21H,11-18,25H2/t21-/m0/s1 |
| InChIKey | WVXAOTKVFVTNQD-NRFANRHFSA-N |
| XLogP | 2.60 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |