About [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol
[2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol (PubChem CID 175849457) has the molecular formula C13H20N4O
and a molecular weight of 248.33 g/mol. Its IUPAC name is [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol |
| PubChem CID | 175849457 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol |
| SMILES | CN1CCC2(CCN(c3nccc(CO)n3)C2)C1 |
| InChI | InChI=1S/C13H20N4O/c1-16-6-3-13(9-16)4-7-17(10-13)12-14-5-2-11(8-18)15-12/h2,5,18H,3-4,6-10H2,1H3 |
| InChIKey | CXRXIOPSQXCJKP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol?
The IUPAC name of [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol (CID 175849457) is [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol.
What is the SMILES notation for [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol?
The canonical SMILES for [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol is CN1CCC2(CCN(c3nccc(CO)n3)C2)C1.
What is the InChIKey of [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol?
The InChIKey is CXRXIOPSQXCJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O/c1-16-6-3-13(9-16)4-7-17(10-13)12-14-5-2-11(8-18)15-12/h2,5,18H,3-4,6-10H2,1H3.
What are the key properties of [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol?
[2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol has a molecular weight of 248.33 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)pyrimidin-4-yl]methanol is sourced from PubChem (CID 175849457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).