C12H18N4 — CID 170131044
(5S)-2-(4-methylpyrimidin-2-yl)-2,7-diazaspiro[4.4]nonane (PubChem CID 170131044) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is (5S)-2-(4-methylpyrimidin-2-yl)-2,7-diazaspiro[4.4]nonane.
| Compound Name | (5S)-2-(4-methylpyrimidin-2-yl)-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 170131044 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (5S)-2-(4-methylpyrimidin-2-yl)-2,7-diazaspiro[4.4]nonane |
| SMILES | Cc1ccnc(N2CC[C@]3(CCNC3)C2)n1 |
| InChI | InChI=1S/C12H18N4/c1-10-2-5-14-11(15-10)16-7-4-12(9-16)3-6-13-8-12/h2,5,13H,3-4,6-9H2,1H3/t12-/m0/s1 |
| InChIKey | UDMMOPHCEJEBHR-LBPRGKRZSA-N |
| XLogP | 0.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |