About 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride
4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride (PubChem CID 154919890) has the molecular formula C16H23Cl2N5
and a molecular weight of 356.30 g/mol. Its IUPAC name is 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride.
Molecular Properties
| Compound Name | 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride |
| PubChem CID | 154919890 |
| Molecular Formula | C16H23Cl2N5 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride |
| SMILES | Cc1ccc2ncnc(N3CCCC4(CCNC4)C3)c2n1.Cl.Cl |
| InChI | InChI=1S/C16H21N5.2ClH/c1-12-3-4-13-14(20-12)15(19-11-18-13)21-8-2-5-16(10-21)6-7-17-9-16;;/h3-4,11,17H,2,5-10H2,1H3;2*1H |
| InChIKey | PNUDOFWNWBKEPI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride?
The IUPAC name of 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride (CID 154919890) is 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride.
What is the SMILES notation for 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride?
The canonical SMILES for 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride is Cc1ccc2ncnc(N3CCCC4(CCNC4)C3)c2n1.Cl.Cl.
What is the InChIKey of 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride?
The InChIKey is PNUDOFWNWBKEPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5.2ClH/c1-12-3-4-13-14(20-12)15(19-11-18-13)21-8-2-5-16(10-21)6-7-17-9-16;;/h3-4,11,17H,2,5-10H2,1H3;2*1H.
What are the key properties of 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride?
4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride has a molecular weight of 356.30 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,7-diazaspiro[4.5]decan-7-yl)-6-methylpyrido[3,2-d]pyrimidine;dihydrochloride is sourced from PubChem (CID 154919890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).