C14H19N5 — CID 122559840
7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,7-diazaspiro[4.5]decane (PubChem CID 122559840) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,7-diazaspiro[4.5]decane.
| Compound Name | 7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 122559840 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,7-diazaspiro[4.5]decane |
| SMILES | c1nc(N2CCCC3(CCNC3)C2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C14H19N5/c1-3-14(4-6-15-8-14)9-19(7-1)13-11-2-5-16-12(11)17-10-18-13/h2,5,10,15H,1,3-4,6-9H2,(H,16,17,18) |
| InChIKey | OPUWGMHWVMNYEV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |