C14H20N4 — CID 139004861
4-(3-ethyl-3-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 139004861) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-(3-ethyl-3-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(3-ethyl-3-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 139004861 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-(3-ethyl-3-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CCC1(C)CCCN(c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C14H20N4/c1-3-14(2)6-4-8-18(9-14)13-11-5-7-15-12(11)16-10-17-13/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,15,16,17) |
| InChIKey | UUACFNVJLLJWNP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |