C15H21N5S — CID 167097568
4-(1-propylsulfanyl-1,7-diazaspiro[3.4]octan-7-yl)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 167097568) has the molecular formula C15H21N5S and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-(1-propylsulfanyl-1,7-diazaspiro[3.4]octan-7-yl)-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(1-propylsulfanyl-1,7-diazaspiro[3.4]octan-7-yl)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 167097568 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-(1-propylsulfanyl-1,7-diazaspiro[3.4]octan-7-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CCCSN1CCC12CCN(c1ncnc3[nH]ccc13)C2 |
| InChI | InChI=1S/C15H21N5S/c1-2-9-21-20-8-5-15(20)4-7-19(10-15)14-12-3-6-16-13(12)17-11-18-14/h3,6,11H,2,4-5,7-10H2,1H3,(H,16,17,18) |
| InChIKey | PMSFYBCWMNDBMZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|