C16H24N6O2S — CID 135242363
(4aR,8aS)-8a-ethyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4,4a,5,6,8-hexahydro-1H-2,7-naphthyridine-2-sulfonamide (PubChem CID 135242363) has the molecular formula C16H24N6O2S and a molecular weight of 364.48 g/mol. Its IUPAC name is (4aR,8aS)-8a-ethyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4,4a,5,6,8-hexahydro-1H-2,7-naphthyridine-2-sulfonamide.
| Compound Name | (4aR,8aS)-8a-ethyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4,4a,5,6,8-hexahydro-1H-2,7-naphthyridine-2-sulfonamide |
|---|---|
| PubChem CID | 135242363 |
| Molecular Formula | C16H24N6O2S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (4aR,8aS)-8a-ethyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4,4a,5,6,8-hexahydro-1H-2,7-naphthyridine-2-sulfonamide |
| SMILES | CC[C@@]12CN(c3ncnc4[nH]ccc34)CC[C@@H]1CCN(S(N)(=O)=O)C2 |
| InChI | InChI=1S/C16H24N6O2S/c1-2-16-9-21(15-13-3-6-18-14(13)19-11-20-15)7-4-12(16)5-8-22(10-16)25(17,23)24/h3,6,11-12H,2,4-5,7-10H2,1H3,(H2,17,23,24)(H,18,19,20)/t12-,16+/m1/s1 |
| InChIKey | OGFAFLQFVXBUOU-WBMJQRKESA-N |
| XLogP | 1.09 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |