C17H25N5O2S — CID 155346532
(4aS,9aS)-9a-methyl-8-methylsulfonyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3,4,4a,5,6,7,9-octahydropyrido[3,4-c]azepine (PubChem CID 155346532) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is (4aS,9aS)-9a-methyl-8-methylsulfonyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3,4,4a,5,6,7,9-octahydropyrido[3,4-c]azepine.
| Compound Name | (4aS,9aS)-9a-methyl-8-methylsulfonyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3,4,4a,5,6,7,9-octahydropyrido[3,4-c]azepine |
|---|---|
| PubChem CID | 155346532 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (4aS,9aS)-9a-methyl-8-methylsulfonyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3,4,4a,5,6,7,9-octahydropyrido[3,4-c]azepine |
| SMILES | C[C@@]12CN(c3ncnc4[nH]ccc34)CC[C@@H]1CCCN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C17H25N5O2S/c1-17-10-21(16-14-5-7-18-15(14)19-12-20-16)9-6-13(17)4-3-8-22(11-17)25(2,23)24/h5,7,12-13H,3-4,6,8-11H2,1-2H3,(H,18,19,20)/t13-,17-/m0/s1 |
| InChIKey | LFSHVVYNZRKJHO-GUYCJALGSA-N |
| XLogP | 1.85 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |