C15H18N6O2 — CID 136513090
5-methyl-5-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 136513090) has the molecular formula C15H18N6O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 5-methyl-5-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 136513090 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 5-methyl-5-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC1(C2CCN(c3ncnc4[nH]ccc34)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C15H18N6O2/c1-15(13(22)19-14(23)20-15)9-3-6-21(7-4-9)12-10-2-5-16-11(10)17-8-18-12/h2,5,8-9H,3-4,6-7H2,1H3,(H,16,17,18)(H2,19,20,22,23) |
| InChIKey | QELOHSHPLSAISF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|