C11H13N5O — CID 146089042
1-methyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-2-one (PubChem CID 146089042) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 1-methyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-2-one.
| Compound Name | 1-methyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 146089042 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-methyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-2-one |
| SMILES | CN1CCN(c2ncnc3[nH]ccc23)CC1=O |
| InChI | InChI=1S/C11H13N5O/c1-15-4-5-16(6-9(15)17)11-8-2-3-12-10(8)13-7-14-11/h2-3,7H,4-6H2,1H3,(H,12,13,14) |
| InChIKey | PXNINZGQRZCPJR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |