C14H17N5O — CID 138386678
(3aR,7aS)-5-methyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 138386678) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is (3aR,7aS)-5-methyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-5-methyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 138386678 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (3aR,7aS)-5-methyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | CN1CC[C@@H]2CN(c3ncnc4[nH]ccc34)C[C@@H]2C1=O |
| InChI | InChI=1S/C14H17N5O/c1-18-5-3-9-6-19(7-11(9)14(18)20)13-10-2-4-15-12(10)16-8-17-13/h2,4,8-9,11H,3,5-7H2,1H3,(H,15,16,17)/t9-,11+/m1/s1 |
| InChIKey | AOEBJOWKDATBGJ-KOLCDFICSA-N |
| XLogP | 0.87 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |