About 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one
4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 171323909) has the molecular formula C14H15N7O
and a molecular weight of 297.32 g/mol. Its IUPAC name is 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one |
| PubChem CID | 171323909 |
| Molecular Formula | C14H15N7O |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(N2CCN(c3ncnc4[nH]ccc34)CC2)nc[nH]1 |
| InChI | InChI=1S/C14H15N7O/c22-12-7-11(16-8-17-12)20-3-5-21(6-4-20)14-10-1-2-15-13(10)18-9-19-14/h1-2,7-9H,3-6H2,(H,15,18,19)(H,16,17,22) |
| InChIKey | RCUORXIKYWGJIW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one?
The IUPAC name of 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one (CID 171323909) is 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one?
The canonical SMILES for 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one is O=c1cc(N2CCN(c3ncnc4[nH]ccc34)CC2)nc[nH]1.
What is the InChIKey of 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one?
The InChIKey is RCUORXIKYWGJIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N7O/c22-12-7-11(16-8-17-12)20-3-5-21(6-4-20)14-10-1-2-15-13(10)18-9-19-14/h1-2,7-9H,3-6H2,(H,15,18,19)(H,16,17,22).
What are the key properties of 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one?
4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one has a molecular weight of 297.32 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-1H-pyrimidin-6-one is sourced from PubChem (CID 171323909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).