C19H18N6 — CID 146091237
2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]quinoline (PubChem CID 146091237) has the molecular formula C19H18N6 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]quinoline.
| Compound Name | 2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 146091237 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]quinoline |
| SMILES | c1ccc2nc(N3CCN(c4ncnc5[nH]ccc45)CC3)ccc2c1 |
| InChI | InChI=1S/C19H18N6/c1-2-4-16-14(3-1)5-6-17(23-16)24-9-11-25(12-10-24)19-15-7-8-20-18(15)21-13-22-19/h1-8,13H,9-12H2,(H,20,21,22) |
| InChIKey | OGHPWCUBADRGEP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |