C12H15N5O2 — CID 172616633
2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]acetic acid (PubChem CID 172616633) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 172616633 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(c2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C12H15N5O2/c18-10(19)7-16-3-5-17(6-4-16)12-9-1-2-13-11(9)14-8-15-12/h1-2,8H,3-7H2,(H,18,19)(H,13,14,15) |
| InChIKey | UENUCTBYKIWRHW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |