C16H23N5O — CID 74235912
1-[(E)-2-methylbut-2-enyl]-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,4-diazepan-6-ol (PubChem CID 74235912) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[(E)-2-methylbut-2-enyl]-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,4-diazepan-6-ol.
| Compound Name | 1-[(E)-2-methylbut-2-enyl]-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 74235912 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-[(E)-2-methylbut-2-enyl]-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,4-diazepan-6-ol |
| SMILES | C/C=C(\C)CN1CCN(c2ncnc3[nH]ccc23)CC(O)C1 |
| InChI | InChI=1S/C16H23N5O/c1-3-12(2)8-20-6-7-21(10-13(22)9-20)16-14-4-5-17-15(14)18-11-19-16/h3-5,11,13,22H,6-10H2,1-2H3,(H,17,18,19)/b12-3+ |
| InChIKey | MHAZMHCRNOJTOF-KGVSQERTSA-N |
| XLogP | 1.41 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|