C14H18N6O2 — CID 166372004
4-oxo-4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]butanamide (PubChem CID 166372004) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 4-oxo-4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]butanamide.
| Compound Name | 4-oxo-4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 166372004 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-oxo-4-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]butanamide |
| SMILES | NC(=O)CCC(=O)N1CCN(c2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C14H18N6O2/c15-11(21)1-2-12(22)19-5-7-20(8-6-19)14-10-3-4-16-13(10)17-9-18-14/h3-4,9H,1-2,5-8H2,(H2,15,21)(H,16,17,18) |
| InChIKey | COUVOJSUZNXHSD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |