C17H21N5O2S — CID 95788188
(5S)-5-[1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 95788188) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is (5S)-5-[1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95788188 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (5S)-5-[1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1sc2ncnc(N3CCC([C@]4(C)NC(=O)NC4=O)CC3)c2c1C |
| InChI | InChI=1S/C17H21N5O2S/c1-9-10(2)25-14-12(9)13(18-8-19-14)22-6-4-11(5-7-22)17(3)15(23)20-16(24)21-17/h8,11H,4-7H2,1-3H3,(H2,20,21,23,24)/t17-/m0/s1 |
| InChIKey | NYGAAOFMPDNQNH-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|