C13H18N4S — CID 18526382
4-(1,4-diazepan-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidine (PubChem CID 18526382) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(1,4-diazepan-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 18526382 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidine |
| SMILES | Cc1sc2ncnc(N3CCCNCC3)c2c1C |
| InChI | InChI=1S/C13H18N4S/c1-9-10(2)18-13-11(9)12(15-8-16-13)17-6-3-4-14-5-7-17/h8,14H,3-7H2,1-2H3 |
| InChIKey | VZHCLKZEVRYHSG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |