C20H22N8 — CID 155323621
5-[8a-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4,4a,5,6,8-hexahydro-1H-2,7-naphthyridin-2-yl]pyrazine-2-carbonitrile (PubChem CID 155323621) has the molecular formula C20H22N8 and a molecular weight of 374.45 g/mol. Its IUPAC name is 5-[8a-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4,4a,5,6,8-hexahydro-1H-2,7-naphthyridin-2-yl]pyrazine-2-carbonitrile.
| Compound Name | 5-[8a-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4,4a,5,6,8-hexahydro-1H-2,7-naphthyridin-2-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 155323621 |
| Molecular Formula | C20H22N8 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 5-[8a-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4,4a,5,6,8-hexahydro-1H-2,7-naphthyridin-2-yl]pyrazine-2-carbonitrile |
| SMILES | CC12CN(c3cnc(C#N)cn3)CCC1CCN(c1ncnc3[nH]ccc13)C2 |
| InChI | InChI=1S/C20H22N8/c1-20-11-27(17-10-23-15(8-21)9-24-17)6-3-14(20)4-7-28(12-20)19-16-2-5-22-18(16)25-13-26-19/h2,5,9-10,13-14H,3-4,6-7,11-12H2,1H3,(H,22,25,26) |
| InChIKey | WCMRANDACFJKSR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |