C13H20N4 — CID 95222078
(5S)-2-(4-methylpyrimidin-2-yl)-2,9-diazaspiro[4.5]decane (PubChem CID 95222078) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is (5S)-2-(4-methylpyrimidin-2-yl)-2,9-diazaspiro[4.5]decane.
| Compound Name | (5S)-2-(4-methylpyrimidin-2-yl)-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 95222078 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (5S)-2-(4-methylpyrimidin-2-yl)-2,9-diazaspiro[4.5]decane |
| SMILES | Cc1ccnc(N2CC[C@]3(CCCNC3)C2)n1 |
| InChI | InChI=1S/C13H20N4/c1-11-3-7-15-12(16-11)17-8-5-13(10-17)4-2-6-14-9-13/h3,7,14H,2,4-6,8-10H2,1H3/t13-/m0/s1 |
| InChIKey | YHOVLQAKQLNDTC-ZDUSSCGKSA-N |
| XLogP | 1.36 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |