C15H22N4O2 — CID 102850615
2-(4-methyl-3-nitro-2-pyridinyl)-2,8-diazaspiro[5.5]undecane (PubChem CID 102850615) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(4-methyl-3-nitro-2-pyridinyl)-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-(4-methyl-3-nitro-2-pyridinyl)-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102850615 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-(4-methyl-3-nitro-2-pyridinyl)-2,8-diazaspiro[5.5]undecane |
| SMILES | Cc1ccnc(N2CCCC3(CCCNC3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N4O2/c1-12-4-8-17-14(13(12)19(20)21)18-9-3-6-15(11-18)5-2-7-16-10-15/h4,8,16H,2-3,5-7,9-11H2,1H3 |
| InChIKey | YKBXZMRCGIQBDH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|