C14H19N3O2 — CID 95228465
2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]pyridine-3-carboxylic acid (PubChem CID 95228465) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]pyridine-3-carboxylic acid.
| Compound Name | 2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 95228465 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1N1CC[C@@]2(CCCNC2)C1 |
| InChI | InChI=1S/C14H19N3O2/c18-13(19)11-3-1-7-16-12(11)17-8-5-14(10-17)4-2-6-15-9-14/h1,3,7,15H,2,4-6,8-10H2,(H,18,19)/t14-/m1/s1 |
| InChIKey | RYLKWYKSWGRHGO-CQSZACIVSA-N |
| XLogP | 1.36 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |