C12H15N7O2 — CID 126823469
1-(4-methyl-3-nitro-2-pyridinyl)-4-(1H-1,2,4-triazol-5-yl)piperazine (PubChem CID 126823469) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-(4-methyl-3-nitro-2-pyridinyl)-4-(1H-1,2,4-triazol-5-yl)piperazine.
| Compound Name | 1-(4-methyl-3-nitro-2-pyridinyl)-4-(1H-1,2,4-triazol-5-yl)piperazine |
|---|---|
| PubChem CID | 126823469 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(4-methyl-3-nitro-2-pyridinyl)-4-(1H-1,2,4-triazol-5-yl)piperazine |
| SMILES | Cc1ccnc(N2CCN(c3ncn[nH]3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N7O2/c1-9-2-3-13-11(10(9)19(20)21)17-4-6-18(7-5-17)12-14-8-15-16-12/h2-3,8H,4-7H2,1H3,(H,14,15,16) |
| InChIKey | VWEGAUOGNPWCER-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|