C16H18N4O2 — CID 125424049
4-methyl-3-nitro-2-[(3S)-3-pyridin-2-ylpiperidin-1-yl]pyridine (PubChem CID 125424049) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-methyl-3-nitro-2-[(3S)-3-pyridin-2-ylpiperidin-1-yl]pyridine.
| Compound Name | 4-methyl-3-nitro-2-[(3S)-3-pyridin-2-ylpiperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 125424049 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-methyl-3-nitro-2-[(3S)-3-pyridin-2-ylpiperidin-1-yl]pyridine |
| SMILES | Cc1ccnc(N2CCC[C@H](c3ccccn3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O2/c1-12-7-9-18-16(15(12)20(21)22)19-10-4-5-13(11-19)14-6-2-3-8-17-14/h2-3,6-9,13H,4-5,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | XELMSMRWLCTMBK-ZDUSSCGKSA-N |
| XLogP | 3.08 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|