C18H19N3O2 — CID 164633507
[2-[(2R)-spiro[chromene-2,3'-piperidine]-1'-yl]pyrimidin-4-yl]methanol (PubChem CID 164633507) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is [2-[(2R)-spiro[chromene-2,3'-piperidine]-1'-yl]pyrimidin-4-yl]methanol.
| Compound Name | [2-[(2R)-spiro[chromene-2,3'-piperidine]-1'-yl]pyrimidin-4-yl]methanol |
|---|---|
| PubChem CID | 164633507 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [2-[(2R)-spiro[chromene-2,3'-piperidine]-1'-yl]pyrimidin-4-yl]methanol |
| SMILES | OCc1ccnc(N2CCC[C@@]3(C=Cc4ccccc4O3)C2)n1 |
| InChI | InChI=1S/C18H19N3O2/c22-12-15-7-10-19-17(20-15)21-11-3-8-18(13-21)9-6-14-4-1-2-5-16(14)23-18/h1-2,4-7,9-10,22H,3,8,11-13H2/t18-/m1/s1 |
| InChIKey | ADQQXEKLMRBIAV-GOSISDBHSA-N |
| XLogP | 2.41 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |