C17H25N3O — CID 98777895
(5R)-2-[(3S)-oxolan-3-yl]-7-pyridin-2-yl-2,7-diazaspiro[4.5]decane (PubChem CID 98777895) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (5R)-2-[(3S)-oxolan-3-yl]-7-pyridin-2-yl-2,7-diazaspiro[4.5]decane.
| Compound Name | (5R)-2-[(3S)-oxolan-3-yl]-7-pyridin-2-yl-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 98777895 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (5R)-2-[(3S)-oxolan-3-yl]-7-pyridin-2-yl-2,7-diazaspiro[4.5]decane |
| SMILES | c1ccc(N2CCC[C@]3(CCN([C@H]4CCOC4)C3)C2)nc1 |
| InChI | InChI=1S/C17H25N3O/c1-2-8-18-16(4-1)20-9-3-6-17(14-20)7-10-19(13-17)15-5-11-21-12-15/h1-2,4,8,15H,3,5-7,9-14H2/t15-,17+/m0/s1 |
| InChIKey | XHXQCHGEJUTSKP-DOTOQJQBSA-N |
| XLogP | 2.16 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |