C19H29N3O — CID 131652843
2-(oxan-4-yl)-9-(pyridin-2-ylmethyl)-2,9-diazaspiro[4.5]decane (PubChem CID 131652843) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-(oxan-4-yl)-9-(pyridin-2-ylmethyl)-2,9-diazaspiro[4.5]decane.
| Compound Name | 2-(oxan-4-yl)-9-(pyridin-2-ylmethyl)-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 131652843 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 2-(oxan-4-yl)-9-(pyridin-2-ylmethyl)-2,9-diazaspiro[4.5]decane |
| SMILES | c1ccc(CN2CCCC3(CCN(C4CCOCC4)C3)C2)nc1 |
| InChI | InChI=1S/C19H29N3O/c1-2-9-20-17(4-1)14-21-10-3-7-19(15-21)8-11-22(16-19)18-5-12-23-13-6-18/h1-2,4,9,18H,3,5-8,10-16H2 |
| InChIKey | QQBHDXGLDLKFTA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |