C20H26N4 — CID 131649183
2,9-bis(pyridin-2-ylmethyl)-2,9-diazaspiro[4.5]decane (PubChem CID 131649183) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2,9-bis(pyridin-2-ylmethyl)-2,9-diazaspiro[4.5]decane.
| Compound Name | 2,9-bis(pyridin-2-ylmethyl)-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 131649183 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 2,9-bis(pyridin-2-ylmethyl)-2,9-diazaspiro[4.5]decane |
| SMILES | c1ccc(CN2CCCC3(CCN(Cc4ccccn4)C3)C2)nc1 |
| InChI | InChI=1S/C20H26N4/c1-3-10-21-18(6-1)14-23-12-5-8-20(16-23)9-13-24(17-20)15-19-7-2-4-11-22-19/h1-4,6-7,10-11H,5,8-9,12-17H2 |
| InChIKey | BPWAAOKHTGOQAN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |