C18H25N3O2 — CID 173174985
(5R)-2-(oxan-4-yl)-9-pyridin-2-yl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 173174985) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (5R)-2-(oxan-4-yl)-9-pyridin-2-yl-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | (5R)-2-(oxan-4-yl)-9-pyridin-2-yl-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 173174985 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (5R)-2-(oxan-4-yl)-9-pyridin-2-yl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(C2CCOCC2)CC[C@@]12CCCN(c1ccccn1)C2 |
| InChI | InChI=1S/C18H25N3O2/c22-17-18(8-11-21(17)15-5-12-23-13-6-15)7-3-10-20(14-18)16-4-1-2-9-19-16/h1-2,4,9,15H,3,5-8,10-14H2/t18-/m1/s1 |
| InChIKey | FECLRFDJZNRCLY-GOSISDBHSA-N |
| XLogP | 2.08 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |